C19H30ClN3O2 — CID 119814666
N-[3-[[(2S)-2-amino-4-methylpentanoyl]amino]phenyl]cyclohexanecarboxamide;hydrochloride (PubChem CID 119814666) has the molecular formula C19H30ClN3O2 and a molecular weight of 367.92 g/mol. Its IUPAC name is N-[3-[[(2S)-2-amino-4-methylpentanoyl]amino]phenyl]cyclohexanecarboxamide;hydrochloride.
| Compound Name | N-[3-[[(2S)-2-amino-4-methylpentanoyl]amino]phenyl]cyclohexanecarboxamide;hydrochloride |
|---|---|
| PubChem CID | 119814666 |
| Molecular Formula | C19H30ClN3O2 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-[3-[[(2S)-2-amino-4-methylpentanoyl]amino]phenyl]cyclohexanecarboxamide;hydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1cccc(NC(=O)C2CCCCC2)c1.Cl |
| InChI | InChI=1S/C19H29N3O2.ClH/c1-13(2)11-17(20)19(24)22-16-10-6-9-15(12-16)21-18(23)14-7-4-3-5-8-14;/h6,9-10,12-14,17H,3-5,7-8,11,20H2,1-2H3,(H,21,23)(H,22,24);1H/t17-;/m0./s1 |
| InChIKey | QZUVTWUUJPUGMT-LMOVPXPDSA-N |
| XLogP | 3.94 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |