C16H23N3O2 — CID 61250751
N-[3-[[(2S)-2-amino-3-methylpentanoyl]amino]phenyl]cyclopropanecarboxamide (PubChem CID 61250751) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[3-[[(2S)-2-amino-3-methylpentanoyl]amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[[(2S)-2-amino-3-methylpentanoyl]amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 61250751 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[3-[[(2S)-2-amino-3-methylpentanoyl]amino]phenyl]cyclopropanecarboxamide |
| SMILES | CCC(C)[C@H](N)C(=O)Nc1cccc(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C16H23N3O2/c1-3-10(2)14(17)16(21)19-13-6-4-5-12(9-13)18-15(20)11-7-8-11/h4-6,9-11,14H,3,7-8,17H2,1-2H3,(H,18,20)(H,19,21)/t10?,14-/m0/s1 |
| InChIKey | RLDQPFKPFHPTIP-SBNLOKMTSA-N |
| XLogP | 2.35 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |