C14H17ClN2O2 — CID 62726652
N-[3-[(3-chloro-2-methylpropanoyl)amino]phenyl]cyclopropanecarboxamide (PubChem CID 62726652) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.76 g/mol. Its IUPAC name is N-[3-[(3-chloro-2-methylpropanoyl)amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[(3-chloro-2-methylpropanoyl)amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 62726652 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-[3-[(3-chloro-2-methylpropanoyl)amino]phenyl]cyclopropanecarboxamide |
| SMILES | CC(CCl)C(=O)Nc1cccc(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C14H17ClN2O2/c1-9(8-15)13(18)16-11-3-2-4-12(7-11)17-14(19)10-5-6-10/h2-4,7,9-10H,5-6,8H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | NDADWMSIUJPOKJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|