C68H72CaF2N4O14 — CID 11981495
calcium bis((3R,5R)-7-[2-(4-fluorophenyl)-4-[(4-hydroxy-2-methoxyphenyl)carbamoyl]-3-phenyl-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate) (PubChem CID 11981495) has the molecular formula C68H72CaF2N4O14 and a molecular weight of 1247.41 g/mol. Its IUPAC name is calcium bis((3R,5R)-7-[2-(4-fluorophenyl)-4-[(4-hydroxy-2-methoxyphenyl)carbamoyl]-3-phenyl-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate).
| Compound Name | calcium bis((3R,5R)-7-[2-(4-fluorophenyl)-4-[(4-hydroxy-2-methoxyphenyl)carbamoyl]-3-phenyl-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate) |
|---|---|
| PubChem CID | 11981495 |
| Molecular Formula | C68H72CaF2N4O14 |
| Molecular Weight | 1247.41 g/mol |
| Exact Mass | 1246.46 |
| IUPAC Name | calcium bis((3R,5R)-7-[2-(4-fluorophenyl)-4-[(4-hydroxy-2-methoxyphenyl)carbamoyl]-3-phenyl-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate) |
| SMILES | COc1cc(O)ccc1NC(=O)c1c(-c2ccccc2)c(-c2ccc(F)cc2)n(CC[C@@H](O)C[C@@H](O)CC(=O)[O-])c1C(C)C.COc1cc(O)ccc1NC(=O)c1c(-c2ccccc2)c(-c2ccc(F)cc2)n(CC[C@@H](O)C[C@@H](O)CC(=O)[O-])c1C(C)C.[Ca+2] |
| InChI | InChI=1S/2C34H37FN2O7.Ca/c2*1-20(2)32-31(34(43)36-27-14-13-24(38)18-28(27)44-3)30(21-7-5-4-6-8-21)33(22-9-11-23(35)12-10-22)37(32)16-15-25(39)17-26(40)19-29(41)42;/h2*4-14,18,20,25-26,38-40H,15-17,19H2,1-3H3,(H,36,43)(H,41,42);/q;;+2/p-2/t2*25-,26-;/m11./s1 |
| InChIKey | UIJVHHWOHPOCAW-CTNAVNBCSA-L |
| XLogP | 9.01 |
| TPSA | 288.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 89 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1247.41 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|