C70H70CaF4N4O14 — CID 11983134
calcium bis((3R,5R)-7-[2-cyclopropyl-3-[(2,4-dimethoxyphenyl)carbamoyl]-4,5-bis(4-fluorophenyl)pyrrol-1-yl]-3,5-dihydroxyheptanoate) (PubChem CID 11983134) has the molecular formula C70H70CaF4N4O14 and a molecular weight of 1307.41 g/mol. Its IUPAC name is calcium bis((3R,5R)-7-[2-cyclopropyl-3-[(2,4-dimethoxyphenyl)carbamoyl]-4,5-bis(4-fluorophenyl)pyrrol-1-yl]-3,5-dihydroxyheptanoate).
| Compound Name | calcium bis((3R,5R)-7-[2-cyclopropyl-3-[(2,4-dimethoxyphenyl)carbamoyl]-4,5-bis(4-fluorophenyl)pyrrol-1-yl]-3,5-dihydroxyheptanoate) |
|---|---|
| PubChem CID | 11983134 |
| Molecular Formula | C70H70CaF4N4O14 |
| Molecular Weight | 1307.41 g/mol |
| Exact Mass | 1306.45 |
| IUPAC Name | calcium bis((3R,5R)-7-[2-cyclopropyl-3-[(2,4-dimethoxyphenyl)carbamoyl]-4,5-bis(4-fluorophenyl)pyrrol-1-yl]-3,5-dihydroxyheptanoate) |
| SMILES | COc1ccc(NC(=O)c2c(-c3ccc(F)cc3)c(-c3ccc(F)cc3)n(CC[C@@H](O)C[C@@H](O)CC(=O)[O-])c2C2CC2)c(OC)c1.COc1ccc(NC(=O)c2c(-c3ccc(F)cc3)c(-c3ccc(F)cc3)n(CC[C@@H](O)C[C@@H](O)CC(=O)[O-])c2C2CC2)c(OC)c1.[Ca+2] |
| InChI | InChI=1S/2C35H36F2N2O7.Ca/c2*1-45-27-13-14-28(29(19-27)46-2)38-35(44)32-31(20-5-9-23(36)10-6-20)33(22-7-11-24(37)12-8-22)39(34(32)21-3-4-21)16-15-25(40)17-26(41)18-30(42)43;/h2*5-14,19,21,25-26,40-41H,3-4,15-18H2,1-2H3,(H,38,44)(H,42,43);/q;;+2/p-2/t2*25-,26-;/m11./s1 |
| InChIKey | VGTUFMQPLUVVNF-CTNAVNBCSA-L |
| XLogP | 9.40 |
| TPSA | 266.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 93 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1307.41 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |