C15H20F2N2O4 — CID 119816482
N-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]morpholine-3-carboxamide (PubChem CID 119816482) has the molecular formula C15H20F2N2O4 and a molecular weight of 330.33 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]morpholine-3-carboxamide.
| Compound Name | N-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119816482 |
| Molecular Formula | C15H20F2N2O4 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]morpholine-3-carboxamide |
| SMILES | CCOc1cccc(CNC(=O)C2COCCN2)c1OC(F)F |
| InChI | InChI=1S/C15H20F2N2O4/c1-2-22-12-5-3-4-10(13(12)23-15(16)17)8-19-14(20)11-9-21-7-6-18-11/h3-5,11,15,18H,2,6-9H2,1H3,(H,19,20) |
| InChIKey | HRYFTIDBNHYWAK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |