C19H20F2N2O5 — CID 122006031
4-[[[2-(difluoromethoxy)-3-ethoxyphenyl]methylcarbamoylamino]methyl]benzoic acid (PubChem CID 122006031) has the molecular formula C19H20F2N2O5 and a molecular weight of 394.37 g/mol. Its IUPAC name is 4-[[[2-(difluoromethoxy)-3-ethoxyphenyl]methylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[[2-(difluoromethoxy)-3-ethoxyphenyl]methylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122006031 |
| Molecular Formula | C19H20F2N2O5 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 4-[[[2-(difluoromethoxy)-3-ethoxyphenyl]methylcarbamoylamino]methyl]benzoic acid |
| SMILES | CCOc1cccc(CNC(=O)NCc2ccc(C(=O)O)cc2)c1OC(F)F |
| InChI | InChI=1S/C19H20F2N2O5/c1-2-27-15-5-3-4-14(16(15)28-18(20)21)11-23-19(26)22-10-12-6-8-13(9-7-12)17(24)25/h3-9,18H,2,10-11H2,1H3,(H,24,25)(H2,22,23,26) |
| InChIKey | SBEQENGQPWNYPW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |