C16H22F2N2O4 — CID 131963379
1-[4-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]piperazin-1-yl]-2-hydroxyethanone (PubChem CID 131963379) has the molecular formula C16H22F2N2O4 and a molecular weight of 344.36 g/mol. Its IUPAC name is 1-[4-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]piperazin-1-yl]-2-hydroxyethanone.
| Compound Name | 1-[4-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]piperazin-1-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 131963379 |
| Molecular Formula | C16H22F2N2O4 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-[4-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]piperazin-1-yl]-2-hydroxyethanone |
| SMILES | CCOc1cccc(CN2CCN(C(=O)CO)CC2)c1OC(F)F |
| InChI | InChI=1S/C16H22F2N2O4/c1-2-23-13-5-3-4-12(15(13)24-16(17)18)10-19-6-8-20(9-7-19)14(22)11-21/h3-5,16,21H,2,6-11H2,1H3 |
| InChIKey | ZWRDVQWYZDHJFV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |