C15H20ClFN2O2 — CID 170962152
2-chloro-1-[4-[(2-ethoxy-6-fluorophenyl)methyl]piperazin-1-yl]ethanone (PubChem CID 170962152) has the molecular formula C15H20ClFN2O2 and a molecular weight of 314.79 g/mol. Its IUPAC name is 2-chloro-1-[4-[(2-ethoxy-6-fluorophenyl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-[(2-ethoxy-6-fluorophenyl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 170962152 |
| Molecular Formula | C15H20ClFN2O2 |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-chloro-1-[4-[(2-ethoxy-6-fluorophenyl)methyl]piperazin-1-yl]ethanone |
| SMILES | CCOc1cccc(F)c1CN1CCN(C(=O)CCl)CC1 |
| InChI | InChI=1S/C15H20ClFN2O2/c1-2-21-14-5-3-4-13(17)12(14)11-18-6-8-19(9-7-18)15(20)10-16/h3-5H,2,6-11H2,1H3 |
| InChIKey | VKKQOCYMTWKBGW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|