C16H21ClN2O2S — CID 119818238
3-amino-N-[[4-(4-methoxyphenyl)thiophen-2-yl]methyl]butanamide;hydrochloride (PubChem CID 119818238) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is 3-amino-N-[[4-(4-methoxyphenyl)thiophen-2-yl]methyl]butanamide;hydrochloride.
| Compound Name | 3-amino-N-[[4-(4-methoxyphenyl)thiophen-2-yl]methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119818238 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-amino-N-[[4-(4-methoxyphenyl)thiophen-2-yl]methyl]butanamide;hydrochloride |
| SMILES | COc1ccc(-c2csc(CNC(=O)CC(C)N)c2)cc1.Cl |
| InChI | InChI=1S/C16H20N2O2S.ClH/c1-11(17)7-16(19)18-9-15-8-13(10-21-15)12-3-5-14(20-2)6-4-12;/h3-6,8,10-11H,7,9,17H2,1-2H3,(H,18,19);1H |
| InChIKey | PDQXQXJFDGJQQL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |