C18H19NO4S — CID 167801951
trans-(1S,2R)-1-[[4-(4-methoxyphenyl)thiophen-2-yl]methylcarbamoyl]-2-methylcyclopropane-1-carboxylic acid (PubChem CID 167801951) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is trans-(1S,2R)-1-[[4-(4-methoxyphenyl)thiophen-2-yl]methylcarbamoyl]-2-methylcyclopropane-1-carboxylic acid.
| Compound Name | trans-(1S,2R)-1-[[4-(4-methoxyphenyl)thiophen-2-yl]methylcarbamoyl]-2-methylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 167801951 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | trans-(1S,2R)-1-[[4-(4-methoxyphenyl)thiophen-2-yl]methylcarbamoyl]-2-methylcyclopropane-1-carboxylic acid |
| SMILES | COc1ccc(-c2csc(CNC(=O)[C@]3(C(=O)O)C[C@H]3C)c2)cc1 |
| InChI | InChI=1S/C18H19NO4S/c1-11-8-18(11,17(21)22)16(20)19-9-15-7-13(10-24-15)12-3-5-14(23-2)6-4-12/h3-7,10-11H,8-9H2,1-2H3,(H,19,20)(H,21,22)/t11-,18+/m1/s1 |
| InChIKey | BIRYCTNHIZCJSB-ZMZPIMSZSA-N |
| XLogP | 3.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|