C20H37ClN2O2 — CID 119818521
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(3-butoxy-2,2-dimethylcyclobutyl)-N-methylacetamide;hydrochloride (PubChem CID 119818521) has the molecular formula C20H37ClN2O2 and a molecular weight of 372.98 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(3-butoxy-2,2-dimethylcyclobutyl)-N-methylacetamide;hydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(3-butoxy-2,2-dimethylcyclobutyl)-N-methylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119818521 |
| Molecular Formula | C20H37ClN2O2 |
| Molecular Weight | 372.98 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(3-butoxy-2,2-dimethylcyclobutyl)-N-methylacetamide;hydrochloride |
| SMILES | CCCCOC1CC(N(C)C(=O)CC2CC3CCC(C2)N3)C1(C)C.Cl |
| InChI | InChI=1S/C20H36N2O2.ClH/c1-5-6-9-24-18-13-17(20(18,2)3)22(4)19(23)12-14-10-15-7-8-16(11-14)21-15;/h14-18,21H,5-13H2,1-4H3;1H |
| InChIKey | FXVVSNOIRUMXFG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.98 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|