C15H31ClN2O2 — CID 119343546
4-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-N-methylbutanamide;hydrochloride (PubChem CID 119343546) has the molecular formula C15H31ClN2O2 and a molecular weight of 306.88 g/mol. Its IUPAC name is 4-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-N-methylbutanamide;hydrochloride.
| Compound Name | 4-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-N-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119343546 |
| Molecular Formula | C15H31ClN2O2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 4-amino-N-(3-butoxy-2,2-dimethylcyclobutyl)-N-methylbutanamide;hydrochloride |
| SMILES | CCCCOC1CC(N(C)C(=O)CCCN)C1(C)C.Cl |
| InChI | InChI=1S/C15H30N2O2.ClH/c1-5-6-10-19-13-11-12(15(13,2)3)17(4)14(18)8-7-9-16;/h12-13H,5-11,16H2,1-4H3;1H |
| InChIKey | TVHFTEGJZULEKJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|