C20H30N2O3 — CID 119818562
methyl 2-methyl-3-phenyl-3-(3-piperidin-4-ylbutanoylamino)propanoate (PubChem CID 119818562) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl 2-methyl-3-phenyl-3-(3-piperidin-4-ylbutanoylamino)propanoate.
| Compound Name | methyl 2-methyl-3-phenyl-3-(3-piperidin-4-ylbutanoylamino)propanoate |
|---|---|
| PubChem CID | 119818562 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | methyl 2-methyl-3-phenyl-3-(3-piperidin-4-ylbutanoylamino)propanoate |
| SMILES | COC(=O)C(C)C(NC(=O)CC(C)C1CCNCC1)c1ccccc1 |
| InChI | InChI=1S/C20H30N2O3/c1-14(16-9-11-21-12-10-16)13-18(23)22-19(15(2)20(24)25-3)17-7-5-4-6-8-17/h4-8,14-16,19,21H,9-13H2,1-3H3,(H,22,23) |
| InChIKey | YTSCNFRGFDTZDU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |