C20H31ClN2O3 — CID 119818551
methyl 2-methyl-3-phenyl-3-(3-piperidin-3-ylbutanoylamino)propanoate;hydrochloride (PubChem CID 119818551) has the molecular formula C20H31ClN2O3 and a molecular weight of 382.93 g/mol. Its IUPAC name is methyl 2-methyl-3-phenyl-3-(3-piperidin-3-ylbutanoylamino)propanoate;hydrochloride.
| Compound Name | methyl 2-methyl-3-phenyl-3-(3-piperidin-3-ylbutanoylamino)propanoate;hydrochloride |
|---|---|
| PubChem CID | 119818551 |
| Molecular Formula | C20H31ClN2O3 |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | methyl 2-methyl-3-phenyl-3-(3-piperidin-3-ylbutanoylamino)propanoate;hydrochloride |
| SMILES | COC(=O)C(C)C(NC(=O)CC(C)C1CCCNC1)c1ccccc1.Cl |
| InChI | InChI=1S/C20H30N2O3.ClH/c1-14(17-10-7-11-21-13-17)12-18(23)22-19(15(2)20(24)25-3)16-8-5-4-6-9-16;/h4-6,8-9,14-15,17,19,21H,7,10-13H2,1-3H3,(H,22,23);1H |
| InChIKey | QFRWPQIJDQHECD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |