C17H28N2O2 — CID 119819943
(2S)-2-amino-3,3-dimethyl-N-[2-(2-methylphenoxy)butyl]butanamide (PubChem CID 119819943) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-[2-(2-methylphenoxy)butyl]butanamide.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-[2-(2-methylphenoxy)butyl]butanamide |
|---|---|
| PubChem CID | 119819943 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-[2-(2-methylphenoxy)butyl]butanamide |
| SMILES | CCC(CNC(=O)[C@@H](N)C(C)(C)C)Oc1ccccc1C |
| InChI | InChI=1S/C17H28N2O2/c1-6-13(21-14-10-8-7-9-12(14)2)11-19-16(20)15(18)17(3,4)5/h7-10,13,15H,6,11,18H2,1-5H3,(H,19,20)/t13?,15-/m1/s1 |
| InChIKey | SPKUNFRVMOBGBD-AWKYBWMHSA-N |
| XLogP | 2.64 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |