C19H27F3N2O — CID 119823787
2-methyl-N-piperidin-4-yl-N-propyl-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 119823787) has the molecular formula C19H27F3N2O and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-methyl-N-piperidin-4-yl-N-propyl-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-methyl-N-piperidin-4-yl-N-propyl-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 119823787 |
| Molecular Formula | C19H27F3N2O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 2-methyl-N-piperidin-4-yl-N-propyl-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCCN(C(=O)C(C)Cc1ccc(C(F)(F)F)cc1)C1CCNCC1 |
| InChI | InChI=1S/C19H27F3N2O/c1-3-12-24(17-8-10-23-11-9-17)18(25)14(2)13-15-4-6-16(7-5-15)19(20,21)22/h4-7,14,17,23H,3,8-13H2,1-2H3 |
| InChIKey | ANPOEOOQRILCSI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |