C17H25FN2OS — CID 119530613
3-(4-fluorophenyl)sulfanyl-2-methyl-N-propyl-N-pyrrolidin-3-ylpropanamide (PubChem CID 119530613) has the molecular formula C17H25FN2OS and a molecular weight of 324.46 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-2-methyl-N-propyl-N-pyrrolidin-3-ylpropanamide.
| Compound Name | 3-(4-fluorophenyl)sulfanyl-2-methyl-N-propyl-N-pyrrolidin-3-ylpropanamide |
|---|---|
| PubChem CID | 119530613 |
| Molecular Formula | C17H25FN2OS |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-2-methyl-N-propyl-N-pyrrolidin-3-ylpropanamide |
| SMILES | CCCN(C(=O)C(C)CSc1ccc(F)cc1)C1CCNC1 |
| InChI | InChI=1S/C17H25FN2OS/c1-3-10-20(15-8-9-19-11-15)17(21)13(2)12-22-16-6-4-14(18)5-7-16/h4-7,13,15,19H,3,8-12H2,1-2H3 |
| InChIKey | OLTKCKFCFNQULF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |