C16H23FN2OS — CID 120555733
3-(4-fluorophenyl)sulfanyl-2-methyl-N-(3-methylpiperidin-4-yl)propanamide (PubChem CID 120555733) has the molecular formula C16H23FN2OS and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-2-methyl-N-(3-methylpiperidin-4-yl)propanamide.
| Compound Name | 3-(4-fluorophenyl)sulfanyl-2-methyl-N-(3-methylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 120555733 |
| Molecular Formula | C16H23FN2OS |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-2-methyl-N-(3-methylpiperidin-4-yl)propanamide |
| SMILES | CC(CSc1ccc(F)cc1)C(=O)NC1CCNCC1C |
| InChI | InChI=1S/C16H23FN2OS/c1-11-9-18-8-7-15(11)19-16(20)12(2)10-21-14-5-3-13(17)4-6-14/h3-6,11-12,15,18H,7-10H2,1-2H3,(H,19,20) |
| InChIKey | RVIMYERUEQYWNI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |