C18H29ClN2O2S — CID 119823825
2-(4-methylsulfanylphenoxy)-N-piperidin-4-yl-N-propylpropanamide;hydrochloride (PubChem CID 119823825) has the molecular formula C18H29ClN2O2S and a molecular weight of 372.96 g/mol. Its IUPAC name is 2-(4-methylsulfanylphenoxy)-N-piperidin-4-yl-N-propylpropanamide;hydrochloride.
| Compound Name | 2-(4-methylsulfanylphenoxy)-N-piperidin-4-yl-N-propylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119823825 |
| Molecular Formula | C18H29ClN2O2S |
| Molecular Weight | 372.96 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-(4-methylsulfanylphenoxy)-N-piperidin-4-yl-N-propylpropanamide;hydrochloride |
| SMILES | CCCN(C(=O)C(C)Oc1ccc(SC)cc1)C1CCNCC1.Cl |
| InChI | InChI=1S/C18H28N2O2S.ClH/c1-4-13-20(15-9-11-19-12-10-15)18(21)14(2)22-16-5-7-17(23-3)8-6-16;/h5-8,14-15,19H,4,9-13H2,1-3H3;1H |
| InChIKey | PDOBPMFDZBZECQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.96 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |