C19H30ClN3O2S — CID 119824897
2-(4-acetamidophenyl)sulfanyl-N-piperidin-4-yl-N-propylpropanamide;hydrochloride (PubChem CID 119824897) has the molecular formula C19H30ClN3O2S and a molecular weight of 399.99 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)sulfanyl-N-piperidin-4-yl-N-propylpropanamide;hydrochloride.
| Compound Name | 2-(4-acetamidophenyl)sulfanyl-N-piperidin-4-yl-N-propylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119824897 |
| Molecular Formula | C19H30ClN3O2S |
| Molecular Weight | 399.99 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-(4-acetamidophenyl)sulfanyl-N-piperidin-4-yl-N-propylpropanamide;hydrochloride |
| SMILES | CCCN(C(=O)C(C)Sc1ccc(NC(C)=O)cc1)C1CCNCC1.Cl |
| InChI | InChI=1S/C19H29N3O2S.ClH/c1-4-13-22(17-9-11-20-12-10-17)19(24)14(2)25-18-7-5-16(6-8-18)21-15(3)23;/h5-8,14,17,20H,4,9-13H2,1-3H3,(H,21,23);1H |
| InChIKey | WKRMOFRTKFZVGX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.99 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |