C18H27ClN4O2 — CID 119824208
2-[(4-chlorophenyl)methylcarbamoylamino]-N-piperidin-4-yl-N-propylacetamide (PubChem CID 119824208) has the molecular formula C18H27ClN4O2 and a molecular weight of 366.89 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylcarbamoylamino]-N-piperidin-4-yl-N-propylacetamide.
| Compound Name | 2-[(4-chlorophenyl)methylcarbamoylamino]-N-piperidin-4-yl-N-propylacetamide |
|---|---|
| PubChem CID | 119824208 |
| Molecular Formula | C18H27ClN4O2 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-[(4-chlorophenyl)methylcarbamoylamino]-N-piperidin-4-yl-N-propylacetamide |
| SMILES | CCCN(C(=O)CNC(=O)NCc1ccc(Cl)cc1)C1CCNCC1 |
| InChI | InChI=1S/C18H27ClN4O2/c1-2-11-23(16-7-9-20-10-8-16)17(24)13-22-18(25)21-12-14-3-5-15(19)6-4-14/h3-6,16,20H,2,7-13H2,1H3,(H2,21,22,25) |
| InChIKey | SCJXTVMYIFKNFW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |