C14H19ClN4O2 — CID 119451180
2-[(4-chlorophenyl)methylcarbamoylamino]-N-pyrrolidin-3-ylacetamide (PubChem CID 119451180) has the molecular formula C14H19ClN4O2 and a molecular weight of 310.78 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylcarbamoylamino]-N-pyrrolidin-3-ylacetamide.
| Compound Name | 2-[(4-chlorophenyl)methylcarbamoylamino]-N-pyrrolidin-3-ylacetamide |
|---|---|
| PubChem CID | 119451180 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[(4-chlorophenyl)methylcarbamoylamino]-N-pyrrolidin-3-ylacetamide |
| SMILES | O=C(CNC(=O)NCc1ccc(Cl)cc1)NC1CCNC1 |
| InChI | InChI=1S/C14H19ClN4O2/c15-11-3-1-10(2-4-11)7-17-14(21)18-9-13(20)19-12-5-6-16-8-12/h1-4,12,16H,5-9H2,(H,19,20)(H2,17,18,21) |
| InChIKey | QSHLUKBLYWRNSA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |