C17H25ClN4O2 — CID 119610394
N-[2-(aminomethyl)cyclohexyl]-2-[(4-chlorophenyl)methylcarbamoylamino]acetamide (PubChem CID 119610394) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-2-[(4-chlorophenyl)methylcarbamoylamino]acetamide.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-2-[(4-chlorophenyl)methylcarbamoylamino]acetamide |
|---|---|
| PubChem CID | 119610394 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-2-[(4-chlorophenyl)methylcarbamoylamino]acetamide |
| SMILES | NCC1CCCCC1NC(=O)CNC(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H25ClN4O2/c18-14-7-5-12(6-8-14)10-20-17(24)21-11-16(23)22-15-4-2-1-3-13(15)9-19/h5-8,13,15H,1-4,9-11,19H2,(H,22,23)(H2,20,21,24) |
| InChIKey | VONMFQWSTGGTPT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |