C16H23ClN4O2 — CID 119566154
N-[1-(aminomethyl)cyclopentyl]-2-[(4-chlorophenyl)methylcarbamoylamino]acetamide (PubChem CID 119566154) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-2-[(4-chlorophenyl)methylcarbamoylamino]acetamide.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-2-[(4-chlorophenyl)methylcarbamoylamino]acetamide |
|---|---|
| PubChem CID | 119566154 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-2-[(4-chlorophenyl)methylcarbamoylamino]acetamide |
| SMILES | NCC1(NC(=O)CNC(=O)NCc2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C16H23ClN4O2/c17-13-5-3-12(4-6-13)9-19-15(23)20-10-14(22)21-16(11-18)7-1-2-8-16/h3-6H,1-2,7-11,18H2,(H,21,22)(H2,19,20,23) |
| InChIKey | MCJCDNWBXMTINT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |