C19H30N2O3S — CID 119825082
3-(3,4-dimethoxyphenyl)sulfanyl-N-piperidin-4-yl-N-propylpropanamide (PubChem CID 119825082) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)sulfanyl-N-piperidin-4-yl-N-propylpropanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)sulfanyl-N-piperidin-4-yl-N-propylpropanamide |
|---|---|
| PubChem CID | 119825082 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)sulfanyl-N-piperidin-4-yl-N-propylpropanamide |
| SMILES | CCCN(C(=O)CCSc1ccc(OC)c(OC)c1)C1CCNCC1 |
| InChI | InChI=1S/C19H30N2O3S/c1-4-12-21(15-7-10-20-11-8-15)19(22)9-13-25-16-5-6-17(23-2)18(14-16)24-3/h5-6,14-15,20H,4,7-13H2,1-3H3 |
| InChIKey | FPLXDIWURLLBLQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |