C17H26ClN3O2 — CID 119533142
3-(5-chloro-2-methoxyanilino)-N-propyl-N-pyrrolidin-3-ylpropanamide (PubChem CID 119533142) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyanilino)-N-propyl-N-pyrrolidin-3-ylpropanamide.
| Compound Name | 3-(5-chloro-2-methoxyanilino)-N-propyl-N-pyrrolidin-3-ylpropanamide |
|---|---|
| PubChem CID | 119533142 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 3-(5-chloro-2-methoxyanilino)-N-propyl-N-pyrrolidin-3-ylpropanamide |
| SMILES | CCCN(C(=O)CCNc1cc(Cl)ccc1OC)C1CCNC1 |
| InChI | InChI=1S/C17H26ClN3O2/c1-3-10-21(14-6-8-19-12-14)17(22)7-9-20-15-11-13(18)4-5-16(15)23-2/h4-5,11,14,19-20H,3,6-10,12H2,1-2H3 |
| InChIKey | DCTVARFRAPJBGG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |