C18H27N3O — CID 119832310
[4-[(3-methylphenyl)methyl]piperazin-1-yl]-piperidin-3-ylmethanone (PubChem CID 119832310) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is [4-[(3-methylphenyl)methyl]piperazin-1-yl]-piperidin-3-ylmethanone.
| Compound Name | [4-[(3-methylphenyl)methyl]piperazin-1-yl]-piperidin-3-ylmethanone |
|---|---|
| PubChem CID | 119832310 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | [4-[(3-methylphenyl)methyl]piperazin-1-yl]-piperidin-3-ylmethanone |
| SMILES | Cc1cccc(CN2CCN(C(=O)C3CCCNC3)CC2)c1 |
| InChI | InChI=1S/C18H27N3O/c1-15-4-2-5-16(12-15)14-20-8-10-21(11-9-20)18(22)17-6-3-7-19-13-17/h2,4-5,12,17,19H,3,6-11,13-14H2,1H3 |
| InChIKey | NQPIIHMAXNFTLB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |