C19H26N2O — CID 51970274
[(1R)-cyclohex-3-en-1-yl]-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 51970274) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is [(1R)-cyclohex-3-en-1-yl]-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [(1R)-cyclohex-3-en-1-yl]-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 51970274 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | [(1R)-cyclohex-3-en-1-yl]-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1cccc(CN2CCN(C(=O)[C@H]3CC=CCC3)CC2)c1 |
| InChI | InChI=1S/C19H26N2O/c1-16-6-5-7-17(14-16)15-20-10-12-21(13-11-20)19(22)18-8-3-2-4-9-18/h2-3,5-7,14,18H,4,8-13,15H2,1H3/t18-/m0/s1 |
| InChIKey | PFVAZPSSDKTTLW-SFHVURJKSA-N |
| XLogP | 3.00 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|