C18H21Cl2N5O — CID 119837128
(3-aminophenyl)-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone;dihydrochloride (PubChem CID 119837128) has the molecular formula C18H21Cl2N5O and a molecular weight of 394.31 g/mol. Its IUPAC name is (3-aminophenyl)-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone;dihydrochloride.
| Compound Name | (3-aminophenyl)-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119837128 |
| Molecular Formula | C18H21Cl2N5O |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | (3-aminophenyl)-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccc(C(=O)N2CCCC(c3nnc4ccccn34)C2)c1 |
| InChI | InChI=1S/C18H19N5O.2ClH/c19-15-7-3-5-13(11-15)18(24)22-9-4-6-14(12-22)17-21-20-16-8-1-2-10-23(16)17;;/h1-3,5,7-8,10-11,14H,4,6,9,12,19H2;2*1H |
| InChIKey | RPPZMOXYTQTOPB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 76.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|