C18H17IN4O — CID 42896883
(2-iodophenyl)-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone (PubChem CID 42896883) has the molecular formula C18H17IN4O and a molecular weight of 432.27 g/mol. Its IUPAC name is (2-iodophenyl)-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (2-iodophenyl)-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42896883 |
| Molecular Formula | C18H17IN4O |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | (2-iodophenyl)-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1I)N1CCCC(c2nnc3ccccn23)C1 |
| InChI | InChI=1S/C18H17IN4O/c19-15-8-2-1-7-14(15)18(24)22-10-5-6-13(12-22)17-21-20-16-9-3-4-11-23(16)17/h1-4,7-9,11,13H,5-6,10,12H2 |
| InChIKey | UQLPJFFYHRBFAQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|