C17H25N5O — CID 119837382
1-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-4-(methylamino)butan-1-one (PubChem CID 119837382) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-4-(methylamino)butan-1-one.
| Compound Name | 1-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-4-(methylamino)butan-1-one |
|---|---|
| PubChem CID | 119837382 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 1-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]-4-(methylamino)butan-1-one |
| SMILES | CNCCCC(=O)N1CCN(Cc2cn3ccccc3n2)CC1 |
| InChI | InChI=1S/C17H25N5O/c1-18-7-4-6-17(23)21-11-9-20(10-12-21)13-15-14-22-8-3-2-5-16(22)19-15/h2-3,5,8,14,18H,4,6-7,9-13H2,1H3 |
| InChIKey | KYGXNJBWLDMNKH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|