C19H24N4O — CID 94468397
2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 94468397) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 94468397 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(C[C@H]1C=CCC1)N1CCN(Cc2cn3ccccc3n2)CC1 |
| InChI | InChI=1S/C19H24N4O/c24-19(13-16-5-1-2-6-16)22-11-9-21(10-12-22)14-17-15-23-8-4-3-7-18(23)20-17/h1,3-5,7-8,15-16H,2,6,9-14H2/t16-/m0/s1 |
| InChIKey | IYSCTMQPGPDFFB-INIZCTEOSA-N |
| XLogP | 2.33 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|