C18H19N5O — CID 94822508
2-[(1S)-cyclopent-2-en-1-yl]-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-4-yl]acetamide (PubChem CID 94822508) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-4-yl]acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 94822508 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[1-(imidazo[1,2-a]pyridin-2-ylmethyl)pyrazol-4-yl]acetamide |
| SMILES | O=C(C[C@H]1C=CCC1)Nc1cnn(Cc2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C18H19N5O/c24-18(9-14-5-1-2-6-14)21-15-10-19-23(12-15)13-16-11-22-8-4-3-7-17(22)20-16/h1,3-5,7-8,10-12,14H,2,6,9,13H2,(H,21,24)/t14-/m0/s1 |
| InChIKey | YGQJZPZAHWHPKP-AWEZNQCLSA-N |
| XLogP | 2.87 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|