C19H25N5O — CID 154736193
N-cyclohex-3-en-1-yl-4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxamide (PubChem CID 154736193) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is N-cyclohex-3-en-1-yl-4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxamide.
| Compound Name | N-cyclohex-3-en-1-yl-4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 154736193 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | N-cyclohex-3-en-1-yl-4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazine-1-carboxamide |
| SMILES | O=C(NC1CC=CCC1)N1CCN(Cc2cn3ccccc3n2)CC1 |
| InChI | InChI=1S/C19H25N5O/c25-19(21-16-6-2-1-3-7-16)23-12-10-22(11-13-23)14-17-15-24-9-5-4-8-18(24)20-17/h1-2,4-5,8-9,15-16H,3,6-7,10-14H2,(H,21,25) |
| InChIKey | CXBYYUAQPBLHQH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|