C23H33N5O — CID 92817222
1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 92817222) has the molecular formula C23H33N5O and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 92817222 |
| Molecular Formula | C23H33N5O |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(Cc2cn3ccccc3n2)CC1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C23H33N5O/c29-23(28-11-5-7-19-6-1-2-8-21(19)28)18-26-14-12-25(13-15-26)16-20-17-27-10-4-3-9-22(27)24-20/h3-4,9-10,17,19,21H,1-2,5-8,11-16,18H2/t19-,21-/m1/s1 |
| InChIKey | IBLKCFZEDACGJO-TZIWHRDSSA-N |
| XLogP | 2.63 |
| TPSA | 44.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |