C20H26Cl3N3O2 — CID 119839292
2-amino-1-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]-2-phenylethanone;dihydrochloride (PubChem CID 119839292) has the molecular formula C20H26Cl3N3O2 and a molecular weight of 446.81 g/mol. Its IUPAC name is 2-amino-1-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]-2-phenylethanone;dihydrochloride.
| Compound Name | 2-amino-1-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]-2-phenylethanone;dihydrochloride |
|---|---|
| PubChem CID | 119839292 |
| Molecular Formula | C20H26Cl3N3O2 |
| Molecular Weight | 446.81 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 2-amino-1-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]-2-phenylethanone;dihydrochloride |
| SMILES | Cl.Cl.NC(C(=O)N1CCN(CCOc2ccccc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H24ClN3O2.2ClH/c21-17-8-4-5-9-18(17)26-15-14-23-10-12-24(13-11-23)20(25)19(22)16-6-2-1-3-7-16;;/h1-9,19H,10-15,22H2;2*1H |
| InChIKey | YKYNXFGCOIWRKR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.81 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |