C28H32ClN3O2 — CID 30622027
(2R)-N-benzhydryl-2-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]propanamide (PubChem CID 30622027) has the molecular formula C28H32ClN3O2 and a molecular weight of 478.04 g/mol. Its IUPAC name is (2R)-N-benzhydryl-2-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-benzhydryl-2-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 30622027 |
| Molecular Formula | C28H32ClN3O2 |
| Molecular Weight | 478.04 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (2R)-N-benzhydryl-2-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NC(c1ccccc1)c1ccccc1)N1CCN(CCOc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C28H32ClN3O2/c1-22(28(33)30-27(23-10-4-2-5-11-23)24-12-6-3-7-13-24)32-18-16-31(17-19-32)20-21-34-26-15-9-8-14-25(26)29/h2-15,22,27H,16-21H2,1H3,(H,30,33)/t22-/m1/s1 |
| InChIKey | MMGVCLGYOMNFJU-JOCHJYFZSA-N |
| XLogP | 4.63 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.04 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |