C20H26N4O2S — CID 119840454
N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 119840454) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 119840454 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | CC1CN(Cc2csc(NC(=O)C3Cc4ccccc4CN3)n2)CC(C)O1 |
| InChI | InChI=1S/C20H26N4O2S/c1-13-9-24(10-14(2)26-13)11-17-12-27-20(22-17)23-19(25)18-7-15-5-3-4-6-16(15)8-21-18/h3-6,12-14,18,21H,7-11H2,1-2H3,(H,22,23,25) |
| InChIKey | VPNOGVLEABLWGL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |