C19H28N4O3S — CID 119843929
4-[4-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]piperazin-1-yl]benzenesulfonamide (PubChem CID 119843929) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is 4-[4-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]piperazin-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]piperazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 119843929 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 4-[4-[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]piperazin-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCN(C(=O)CC3CC4CCC(C3)N4)CC2)cc1 |
| InChI | InChI=1S/C19H28N4O3S/c20-27(25,26)18-5-3-17(4-6-18)22-7-9-23(10-8-22)19(24)13-14-11-15-1-2-16(12-14)21-15/h3-6,14-16,21H,1-2,7-13H2,(H2,20,25,26) |
| InChIKey | XDGIOPPFKDEGHJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |