C14H28Cl2N4O2 — CID 119844022
N-ethyl-2-[4-(2-pyrrolidin-2-ylacetyl)piperazin-1-yl]acetamide;dihydrochloride (PubChem CID 119844022) has the molecular formula C14H28Cl2N4O2 and a molecular weight of 355.31 g/mol. Its IUPAC name is N-ethyl-2-[4-(2-pyrrolidin-2-ylacetyl)piperazin-1-yl]acetamide;dihydrochloride.
| Compound Name | N-ethyl-2-[4-(2-pyrrolidin-2-ylacetyl)piperazin-1-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119844022 |
| Molecular Formula | C14H28Cl2N4O2 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-ethyl-2-[4-(2-pyrrolidin-2-ylacetyl)piperazin-1-yl]acetamide;dihydrochloride |
| SMILES | CCNC(=O)CN1CCN(C(=O)CC2CCCN2)CC1.Cl.Cl |
| InChI | InChI=1S/C14H26N4O2.2ClH/c1-2-15-13(19)11-17-6-8-18(9-7-17)14(20)10-12-4-3-5-16-12;;/h12,16H,2-11H2,1H3,(H,15,19);2*1H |
| InChIKey | GRYOPEAYRHWEGW-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |