C14H28Cl2N4O2S — CID 119941053
N-ethyl-2-[4-(2-thiomorpholin-3-ylacetyl)piperazin-1-yl]acetamide;dihydrochloride (PubChem CID 119941053) has the molecular formula C14H28Cl2N4O2S and a molecular weight of 387.38 g/mol. Its IUPAC name is N-ethyl-2-[4-(2-thiomorpholin-3-ylacetyl)piperazin-1-yl]acetamide;dihydrochloride.
| Compound Name | N-ethyl-2-[4-(2-thiomorpholin-3-ylacetyl)piperazin-1-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119941053 |
| Molecular Formula | C14H28Cl2N4O2S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-ethyl-2-[4-(2-thiomorpholin-3-ylacetyl)piperazin-1-yl]acetamide;dihydrochloride |
| SMILES | CCNC(=O)CN1CCN(C(=O)CC2CSCCN2)CC1.Cl.Cl |
| InChI | InChI=1S/C14H26N4O2S.2ClH/c1-2-15-13(19)10-17-4-6-18(7-5-17)14(20)9-12-11-21-8-3-16-12;;/h12,16H,2-11H2,1H3,(H,15,19);2*1H |
| InChIKey | FOCBXFZWNJDUKH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |