C17H32ClN3O2S — CID 119936671
N-pentyl-1-(2-thiomorpholin-3-ylacetyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 119936671) has the molecular formula C17H32ClN3O2S and a molecular weight of 377.98 g/mol. Its IUPAC name is N-pentyl-1-(2-thiomorpholin-3-ylacetyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-pentyl-1-(2-thiomorpholin-3-ylacetyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119936671 |
| Molecular Formula | C17H32ClN3O2S |
| Molecular Weight | 377.98 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-pentyl-1-(2-thiomorpholin-3-ylacetyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | CCCCCNC(=O)C1CCN(C(=O)CC2CSCCN2)CC1.Cl |
| InChI | InChI=1S/C17H31N3O2S.ClH/c1-2-3-4-7-19-17(22)14-5-9-20(10-6-14)16(21)12-15-13-23-11-8-18-15;/h14-15,18H,2-13H2,1H3,(H,19,22);1H |
| InChIKey | XHMWDMGVDUJSID-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.98 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|