C16H30ClN3O2S — CID 119936798
N-butyl-1-(2-thiomorpholin-3-ylacetyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 119936798) has the molecular formula C16H30ClN3O2S and a molecular weight of 363.96 g/mol. Its IUPAC name is N-butyl-1-(2-thiomorpholin-3-ylacetyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | N-butyl-1-(2-thiomorpholin-3-ylacetyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119936798 |
| Molecular Formula | C16H30ClN3O2S |
| Molecular Weight | 363.96 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N-butyl-1-(2-thiomorpholin-3-ylacetyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | CCCCNC(=O)C1CCN(C(=O)CC2CSCCN2)CC1.Cl |
| InChI | InChI=1S/C16H29N3O2S.ClH/c1-2-3-6-18-16(21)13-4-8-19(9-5-13)15(20)11-14-12-22-10-7-17-14;/h13-14,17H,2-12H2,1H3,(H,18,21);1H |
| InChIKey | BMEIJEHUJXTINZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.96 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|