C21H33N3O — CID 119845563
1-amino-N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]cyclohexane-1-carboxamide (PubChem CID 119845563) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is 1-amino-N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]cyclohexane-1-carboxamide.
| Compound Name | 1-amino-N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119845563 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 1-amino-N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]cyclohexane-1-carboxamide |
| SMILES | CC1CCCN(Cc2ccccc2CNC(=O)C2(N)CCCCC2)C1 |
| InChI | InChI=1S/C21H33N3O/c1-17-8-7-13-24(15-17)16-19-10-4-3-9-18(19)14-23-20(25)21(22)11-5-2-6-12-21/h3-4,9-10,17H,2,5-8,11-16,22H2,1H3,(H,23,25) |
| InChIKey | QZOBEGJKHUQUCC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |