C24H31N3O2 — CID 51947424
2-(4-acetamidophenyl)-N-[[2-[[(3S)-3-methylpiperidin-1-yl]methyl]phenyl]methyl]acetamide (PubChem CID 51947424) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)-N-[[2-[[(3S)-3-methylpiperidin-1-yl]methyl]phenyl]methyl]acetamide.
| Compound Name | 2-(4-acetamidophenyl)-N-[[2-[[(3S)-3-methylpiperidin-1-yl]methyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 51947424 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 2-(4-acetamidophenyl)-N-[[2-[[(3S)-3-methylpiperidin-1-yl]methyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CC(=O)NCc2ccccc2CN2CCC[C@H](C)C2)cc1 |
| InChI | InChI=1S/C24H31N3O2/c1-18-6-5-13-27(16-18)17-22-8-4-3-7-21(22)15-25-24(29)14-20-9-11-23(12-10-20)26-19(2)28/h3-4,7-12,18H,5-6,13-17H2,1-2H3,(H,25,29)(H,26,28)/t18-/m0/s1 |
| InChIKey | VNSDVODHGXWLES-SFHVURJKSA-N |
| XLogP | 3.74 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |