C17H18FN3O3 — CID 119847828
N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]morpholine-3-carboxamide (PubChem CID 119847828) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]morpholine-3-carboxamide.
| Compound Name | N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119847828 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]morpholine-3-carboxamide |
| SMILES | O=C(NCc1cccnc1Oc1cccc(F)c1)C1COCCN1 |
| InChI | InChI=1S/C17H18FN3O3/c18-13-4-1-5-14(9-13)24-17-12(3-2-6-20-17)10-21-16(22)15-11-23-8-7-19-15/h1-6,9,15,19H,7-8,10-11H2,(H,21,22) |
| InChIKey | AXFWOETZFRRFKV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |