C24H25FN4O3 — CID 47051100
1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[2-(morpholin-4-ylmethyl)phenyl]urea (PubChem CID 47051100) has the molecular formula C24H25FN4O3 and a molecular weight of 436.49 g/mol. Its IUPAC name is 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[2-(morpholin-4-ylmethyl)phenyl]urea.
| Compound Name | 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[2-(morpholin-4-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 47051100 |
| Molecular Formula | C24H25FN4O3 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[2-(morpholin-4-ylmethyl)phenyl]urea |
| SMILES | O=C(NCc1cccnc1Oc1cccc(F)c1)Nc1ccccc1CN1CCOCC1 |
| InChI | InChI=1S/C24H25FN4O3/c25-20-7-3-8-21(15-20)32-23-18(6-4-10-26-23)16-27-24(30)28-22-9-2-1-5-19(22)17-29-11-13-31-14-12-29/h1-10,15H,11-14,16-17H2,(H2,27,28,30) |
| InChIKey | HTPCJRVIEQKSEN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |