C22H21FN6O3 — CID 47041085
1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]urea (PubChem CID 47041085) has the molecular formula C22H21FN6O3 and a molecular weight of 436.45 g/mol. Its IUPAC name is 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]urea.
| Compound Name | 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 47041085 |
| Molecular Formula | C22H21FN6O3 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[6-(3-oxopiperazin-1-yl)-3-pyridinyl]urea |
| SMILES | O=C1CN(c2ccc(NC(=O)NCc3cccnc3Oc3cccc(F)c3)cn2)CCN1 |
| InChI | InChI=1S/C22H21FN6O3/c23-16-4-1-5-18(11-16)32-21-15(3-2-8-25-21)12-27-22(31)28-17-6-7-19(26-13-17)29-10-9-24-20(30)14-29/h1-8,11,13H,9-10,12,14H2,(H,24,30)(H2,27,28,31) |
| InChIKey | YUHZSORBKKLYCV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |