C21H25FN4O4 — CID 55741558
ethyl 4-[[2-(3-fluorophenoxy)-3-pyridinyl]methylcarbamoylamino]piperidine-1-carboxylate (PubChem CID 55741558) has the molecular formula C21H25FN4O4 and a molecular weight of 416.45 g/mol. Its IUPAC name is ethyl 4-[[2-(3-fluorophenoxy)-3-pyridinyl]methylcarbamoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(3-fluorophenoxy)-3-pyridinyl]methylcarbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55741558 |
| Molecular Formula | C21H25FN4O4 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | ethyl 4-[[2-(3-fluorophenoxy)-3-pyridinyl]methylcarbamoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)NCc2cccnc2Oc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H25FN4O4/c1-2-29-21(28)26-11-8-17(9-12-26)25-20(27)24-14-15-5-4-10-23-19(15)30-18-7-3-6-16(22)13-18/h3-7,10,13,17H,2,8-9,11-12,14H2,1H3,(H2,24,25,27) |
| InChIKey | MJYCXAHFFSNCAS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |